C14H21F2N3 — CID 115506828
1-N-[(1-ethylpiperidin-4-yl)methyl]-3,5-difluorobenzene-1,2-diamine (PubChem CID 115506828) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-N-[(1-ethylpiperidin-4-yl)methyl]-3,5-difluorobenzene-1,2-diamine.
| Compound Name | 1-N-[(1-ethylpiperidin-4-yl)methyl]-3,5-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115506828 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-N-[(1-ethylpiperidin-4-yl)methyl]-3,5-difluorobenzene-1,2-diamine |
| SMILES | CCN1CCC(CNc2cc(F)cc(F)c2N)CC1 |
| InChI | InChI=1S/C14H21F2N3/c1-2-19-5-3-10(4-6-19)9-18-13-8-11(15)7-12(16)14(13)17/h7-8,10,18H,2-6,9,17H2,1H3 |
| InChIKey | LAHCWXBWLQRDRC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|