C14H20F2N2 — CID 114136547
1-N-(3-cyclopentylpropyl)-3,5-difluorobenzene-1,2-diamine (PubChem CID 114136547) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-N-(3-cyclopentylpropyl)-3,5-difluorobenzene-1,2-diamine.
| Compound Name | 1-N-(3-cyclopentylpropyl)-3,5-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 114136547 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-N-(3-cyclopentylpropyl)-3,5-difluorobenzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1NCCCC1CCCC1 |
| InChI | InChI=1S/C14H20F2N2/c15-11-8-12(16)14(17)13(9-11)18-7-3-6-10-4-1-2-5-10/h8-10,18H,1-7,17H2 |
| InChIKey | HJTOHDFXQRLUPJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|