C15H21FN2O2 — CID 106003908
2-amino-6-(3-cyclopentylpropylamino)-3-fluorobenzoic acid (PubChem CID 106003908) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-amino-6-(3-cyclopentylpropylamino)-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-(3-cyclopentylpropylamino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 106003908 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-amino-6-(3-cyclopentylpropylamino)-3-fluorobenzoic acid |
| SMILES | Nc1c(F)ccc(NCCCC2CCCC2)c1C(=O)O |
| InChI | InChI=1S/C15H21FN2O2/c16-11-7-8-12(13(14(11)17)15(19)20)18-9-3-6-10-4-1-2-5-10/h7-8,10,18H,1-6,9,17H2,(H,19,20) |
| InChIKey | IVNILRKJEUFAPB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|