C13H18FN3O3 — CID 83207393
2-amino-3-fluoro-6-[[3-oxo-3-(propylamino)propyl]amino]benzoic acid (PubChem CID 83207393) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-[[3-oxo-3-(propylamino)propyl]amino]benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-[[3-oxo-3-(propylamino)propyl]amino]benzoic acid |
|---|---|
| PubChem CID | 83207393 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-amino-3-fluoro-6-[[3-oxo-3-(propylamino)propyl]amino]benzoic acid |
| SMILES | CCCNC(=O)CCNc1ccc(F)c(N)c1C(=O)O |
| InChI | InChI=1S/C13H18FN3O3/c1-2-6-17-10(18)5-7-16-9-4-3-8(14)12(15)11(9)13(19)20/h3-4,16H,2,5-7,15H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JVYYIXYTUAGVAG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|