C9H9F5N2S — CID 114187357
3,5-difluoro-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine (PubChem CID 114187357) has the molecular formula C9H9F5N2S and a molecular weight of 272.24 g/mol. Its IUPAC name is 3,5-difluoro-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 114187357 |
| Molecular Formula | C9H9F5N2S |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3,5-difluoro-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1NCCSC(F)(F)F |
| InChI | InChI=1S/C9H9F5N2S/c10-5-3-6(11)8(15)7(4-5)16-1-2-17-9(12,13)14/h3-4,16H,1-2,15H2 |
| InChIKey | SJMWTHCNAPQKSO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|