C11H14F4N2OS — CID 106426443
4-ethoxy-5-fluoro-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine (PubChem CID 106426443) has the molecular formula C11H14F4N2OS and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-ethoxy-5-fluoro-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-ethoxy-5-fluoro-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106426443 |
| Molecular Formula | C11H14F4N2OS |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-ethoxy-5-fluoro-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
| SMILES | CCOc1cc(NCCSC(F)(F)F)c(N)cc1F |
| InChI | InChI=1S/C11H14F4N2OS/c1-2-18-10-6-9(8(16)5-7(10)12)17-3-4-19-11(13,14)15/h5-6,17H,2-4,16H2,1H3 |
| InChIKey | QDCTWSLKJWEFGJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|