C13H21FN2O2 — CID 63594299
4-ethoxy-5-fluoro-2-N-(4-methoxybutyl)benzene-1,2-diamine (PubChem CID 63594299) has the molecular formula C13H21FN2O2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 4-ethoxy-5-fluoro-2-N-(4-methoxybutyl)benzene-1,2-diamine.
| Compound Name | 4-ethoxy-5-fluoro-2-N-(4-methoxybutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63594299 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-ethoxy-5-fluoro-2-N-(4-methoxybutyl)benzene-1,2-diamine |
| SMILES | CCOc1cc(NCCCCOC)c(N)cc1F |
| InChI | InChI=1S/C13H21FN2O2/c1-3-18-13-9-12(11(15)8-10(13)14)16-6-4-5-7-17-2/h8-9,16H,3-7,15H2,1-2H3 |
| InChIKey | CWNJYRPPVTXYOS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|