C9H9F4IN2S — CID 106426519
4-fluoro-5-iodo-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine (PubChem CID 106426519) has the molecular formula C9H9F4IN2S and a molecular weight of 380.15 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-iodo-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106426519 |
| Molecular Formula | C9H9F4IN2S |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 4-fluoro-5-iodo-2-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(I)c(F)cc1NCCSC(F)(F)F |
| InChI | InChI=1S/C9H9F4IN2S/c10-5-3-8(7(15)4-6(5)14)16-1-2-17-9(11,12)13/h3-4,16H,1-2,15H2 |
| InChIKey | SNAVCDCJSLUJQA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|