C10H9F5N2S2 — CID 106428952
3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzenecarbothioamide (PubChem CID 106428952) has the molecular formula C10H9F5N2S2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106428952 |
| Molecular Formula | C10H9F5N2S2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(NCCSC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C10H9F5N2S2/c11-6-3-5(9(16)18)4-7(12)8(6)17-1-2-19-10(13,14)15/h3-4,17H,1-2H2,(H2,16,18) |
| InChIKey | SNEGSYYYMZSRPO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|