C11H15F2N3O2S2 — CID 106339319
4-[2-(ethylsulfamoyl)ethylamino]-3,5-difluorobenzenecarbothioamide (PubChem CID 106339319) has the molecular formula C11H15F2N3O2S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[2-(ethylsulfamoyl)ethylamino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[2-(ethylsulfamoyl)ethylamino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106339319 |
| Molecular Formula | C11H15F2N3O2S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-[2-(ethylsulfamoyl)ethylamino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CCNS(=O)(=O)CCNc1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C11H15F2N3O2S2/c1-2-16-20(17,18)4-3-15-10-8(12)5-7(11(14)19)6-9(10)13/h5-6,15-16H,2-4H2,1H3,(H2,14,19) |
| InChIKey | IIFODMIUAKQHPY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|