C15H23F2N3S — CID 81286900
4-[2-[di(propan-2-yl)amino]ethylamino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286900) has the molecular formula C15H23F2N3S and a molecular weight of 315.43 g/mol. Its IUPAC name is 4-[2-[di(propan-2-yl)amino]ethylamino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[2-[di(propan-2-yl)amino]ethylamino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286900 |
| Molecular Formula | C15H23F2N3S |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-[2-[di(propan-2-yl)amino]ethylamino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CC(C)N(CCNc1c(F)cc(C(N)=S)cc1F)C(C)C |
| InChI | InChI=1S/C15H23F2N3S/c1-9(2)20(10(3)4)6-5-19-14-12(16)7-11(15(18)21)8-13(14)17/h7-10,19H,5-6H2,1-4H3,(H2,18,21) |
| InChIKey | NUBUTWBYMSBELS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|