C16H16F2N2S — CID 81286027
4-[(2-ethylphenyl)methylamino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286027) has the molecular formula C16H16F2N2S and a molecular weight of 306.38 g/mol. Its IUPAC name is 4-[(2-ethylphenyl)methylamino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[(2-ethylphenyl)methylamino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286027 |
| Molecular Formula | C16H16F2N2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[(2-ethylphenyl)methylamino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CCc1ccccc1CNc1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C16H16F2N2S/c1-2-10-5-3-4-6-11(10)9-20-15-13(17)7-12(16(19)21)8-14(15)18/h3-8,20H,2,9H2,1H3,(H2,19,21) |
| InChIKey | ZHIVTFPTOPFQGJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|