C15H14F2N2OS — CID 81285851
3,5-difluoro-4-[(3-methoxyphenyl)methylamino]benzenecarbothioamide (PubChem CID 81285851) has the molecular formula C15H14F2N2OS and a molecular weight of 308.35 g/mol. Its IUPAC name is 3,5-difluoro-4-[(3-methoxyphenyl)methylamino]benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-[(3-methoxyphenyl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 81285851 |
| Molecular Formula | C15H14F2N2OS |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3,5-difluoro-4-[(3-methoxyphenyl)methylamino]benzenecarbothioamide |
| SMILES | COc1cccc(CNc2c(F)cc(C(N)=S)cc2F)c1 |
| InChI | InChI=1S/C15H14F2N2OS/c1-20-11-4-2-3-9(5-11)8-19-14-12(16)6-10(15(18)21)7-13(14)17/h2-7,19H,8H2,1H3,(H2,18,21) |
| InChIKey | DVYCJXJHZPPQQC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|