C13H21F2N3 — CID 114139257
3,5-difluoro-1-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,2-diamine (PubChem CID 114139257) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3,5-difluoro-1-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 114139257 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 3,5-difluoro-1-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,2-diamine |
| SMILES | CC(C)N(C)CCCNc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C13H21F2N3/c1-9(2)18(3)6-4-5-17-12-8-10(14)7-11(15)13(12)16/h7-9,17H,4-6,16H2,1-3H3 |
| InChIKey | HQUNLDIVLXJSEA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|