C13H23N3 — CID 106036365
4-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,4-diamine (PubChem CID 106036365) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 4-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,4-diamine.
| Compound Name | 4-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 106036365 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 4-N-[3-[methyl(propan-2-yl)amino]propyl]benzene-1,4-diamine |
| SMILES | CC(C)N(C)CCCNc1ccc(N)cc1 |
| InChI | InChI=1S/C13H23N3/c1-11(2)16(3)10-4-9-15-13-7-5-12(14)6-8-13/h5-8,11,15H,4,9-10,14H2,1-3H3 |
| InChIKey | ZIDOEBADTYWXQR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|