C19H29N5 — CID 58794813
1-N,5-N-bis(4-aminophenyl)-3-N,3-N-dimethylpentane-1,3,5-triamine (PubChem CID 58794813) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-N,5-N-bis(4-aminophenyl)-3-N,3-N-dimethylpentane-1,3,5-triamine.
| Compound Name | 1-N,5-N-bis(4-aminophenyl)-3-N,3-N-dimethylpentane-1,3,5-triamine |
|---|---|
| PubChem CID | 58794813 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 1-N,5-N-bis(4-aminophenyl)-3-N,3-N-dimethylpentane-1,3,5-triamine |
| SMILES | CN(C)C(CCNc1ccc(N)cc1)CCNc1ccc(N)cc1 |
| InChI | InChI=1S/C19H29N5/c1-24(2)19(11-13-22-17-7-3-15(20)4-8-17)12-14-23-18-9-5-16(21)6-10-18/h3-10,19,22-23H,11-14,20-21H2,1-2H3 |
| InChIKey | MILWFPGJAZCEDR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|