C9H15ClN2O — CID 68602874
4-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride (PubChem CID 68602874) has the molecular formula C9H15ClN2O and a molecular weight of 202.69 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride.
| Compound Name | 4-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 68602874 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 4-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride |
| SMILES | COCCNc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C9H14N2O.ClH/c1-12-7-6-11-9-4-2-8(10)3-5-9;/h2-5,11H,6-7,10H2,1H3;1H |
| InChIKey | QRKMASJZGGENKJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|