C32H53BrN4O6 — CID 159155996
1-bromo-2-methoxyethane;tert-butyl N-[2-(4-aminophenyl)ethyl]carbamate;tert-butyl N-[2-[4-(2-methoxyethylamino)phenyl]ethyl]carbamate (PubChem CID 159155996) has the molecular formula C32H53BrN4O6 and a molecular weight of 669.70 g/mol. Its IUPAC name is 1-bromo-2-methoxyethane;tert-butyl N-[2-(4-aminophenyl)ethyl]carbamate;tert-butyl N-[2-[4-(2-methoxyethylamino)phenyl]ethyl]carbamate.
| Compound Name | 1-bromo-2-methoxyethane;tert-butyl N-[2-(4-aminophenyl)ethyl]carbamate;tert-butyl N-[2-[4-(2-methoxyethylamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 159155996 |
| Molecular Formula | C32H53BrN4O6 |
| Molecular Weight | 669.70 g/mol |
| Exact Mass | 668.31 |
| IUPAC Name | 1-bromo-2-methoxyethane;tert-butyl N-[2-(4-aminophenyl)ethyl]carbamate;tert-butyl N-[2-[4-(2-methoxyethylamino)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(N)cc1.COCCBr.COCCNc1ccc(CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3.C13H20N2O2.C3H7BrO/c1-16(2,3)21-15(19)18-10-9-13-5-7-14(8-6-13)17-11-12-20-4;1-13(2,3)17-12(16)15-9-8-10-4-6-11(14)7-5-10;1-5-3-2-4/h5-8,17H,9-12H2,1-4H3,(H,18,19);4-7H,8-9,14H2,1-3H3,(H,15,16);2-3H2,1H3 |
| InChIKey | KJXABXCLKLFLES-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|