C21H27N3O3S — CID 69387898
tert-butyl N-[4-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]sulfanylphenyl]carbamate (PubChem CID 69387898) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]sulfanylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 69387898 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl N-[4-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]sulfanylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(SCC(=O)NCCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-21(2,3)27-20(26)24-17-8-10-18(11-9-17)28-14-19(25)23-13-12-15-4-6-16(22)7-5-15/h4-11H,12-14,22H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | OLHNFSPLEPHLOD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|