C22H29N3O3S — CID 58756782
tert-butyl N-[4-[2-[3-(4-aminophenyl)propylamino]-2-oxoethyl]sulfanylphenyl]carbamate (PubChem CID 58756782) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[3-(4-aminophenyl)propylamino]-2-oxoethyl]sulfanylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[3-(4-aminophenyl)propylamino]-2-oxoethyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 58756782 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | tert-butyl N-[4-[2-[3-(4-aminophenyl)propylamino]-2-oxoethyl]sulfanylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(SCC(=O)NCCCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-22(2,3)28-21(27)25-18-10-12-19(13-11-18)29-15-20(26)24-14-4-5-16-6-8-17(23)9-7-16/h6-13H,4-5,14-15,23H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | GBQXAYLJUIQZJQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|