C22H30N2O4 — CID 142744776
tert-butyl N-[4-[4-(4-amino-2-methoxyphenoxy)butyl]phenyl]carbamate (PubChem CID 142744776) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(4-amino-2-methoxyphenoxy)butyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(4-amino-2-methoxyphenoxy)butyl]phenyl]carbamate |
|---|---|
| PubChem CID | 142744776 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl N-[4-[4-(4-amino-2-methoxyphenoxy)butyl]phenyl]carbamate |
| SMILES | COc1cc(N)ccc1OCCCCc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O4/c1-22(2,3)28-21(25)24-18-11-8-16(9-12-18)7-5-6-14-27-19-13-10-17(23)15-20(19)26-4/h8-13,15H,5-7,14,23H2,1-4H3,(H,24,25) |
| InChIKey | LWRVFGAQHFFLMG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|