C20H32BrNO3 — CID 122595944
tert-butyl N-[2-[4-(6-bromohexoxymethyl)phenyl]ethyl]carbamate (PubChem CID 122595944) has the molecular formula C20H32BrNO3 and a molecular weight of 414.38 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(6-bromohexoxymethyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(6-bromohexoxymethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 122595944 |
| Molecular Formula | C20H32BrNO3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | tert-butyl N-[2-[4-(6-bromohexoxymethyl)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(COCCCCCCBr)cc1 |
| InChI | InChI=1S/C20H32BrNO3/c1-20(2,3)25-19(23)22-14-12-17-8-10-18(11-9-17)16-24-15-7-5-4-6-13-21/h8-11H,4-7,12-16H2,1-3H3,(H,22,23) |
| InChIKey | UYAIJNNAYKMRAS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|