C9H16N2O5S — CID 71375043
4-N-(2-methoxyethyl)benzene-1,4-diamine;sulfuric acid (PubChem CID 71375043) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)benzene-1,4-diamine;sulfuric acid.
| Compound Name | 4-N-(2-methoxyethyl)benzene-1,4-diamine;sulfuric acid |
|---|---|
| PubChem CID | 71375043 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-N-(2-methoxyethyl)benzene-1,4-diamine;sulfuric acid |
| SMILES | COCCNc1ccc(N)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H14N2O.H2O4S/c1-12-7-6-11-9-4-2-8(10)3-5-9;1-5(2,3)4/h2-5,11H,6-7,10H2,1H3;(H2,1,2,3,4) |
| InChIKey | ICTNREHFNBMLKP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|