C13H23N3O2 — CID 142398734
4-N-(3-amino-2-methoxypropyl)-1-N-(2-methoxyethyl)benzene-1,4-diamine (PubChem CID 142398734) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-N-(3-amino-2-methoxypropyl)-1-N-(2-methoxyethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(3-amino-2-methoxypropyl)-1-N-(2-methoxyethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 142398734 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 4-N-(3-amino-2-methoxypropyl)-1-N-(2-methoxyethyl)benzene-1,4-diamine |
| SMILES | COCCNc1ccc(NCC(CN)OC)cc1 |
| InChI | InChI=1S/C13H23N3O2/c1-17-8-7-15-11-3-5-12(6-4-11)16-10-13(9-14)18-2/h3-6,13,15-16H,7-10,14H2,1-2H3 |
| InChIKey | HLJBPULGKCFDHU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|