C28H36N2O2 — CID 142154386
N-(2-methoxyethyl)-4-[4-[4-(2-methoxyethylamino)phenyl]-2,3,5,6-tetramethylphenyl]aniline (PubChem CID 142154386) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[4-[4-(2-methoxyethylamino)phenyl]-2,3,5,6-tetramethylphenyl]aniline.
| Compound Name | N-(2-methoxyethyl)-4-[4-[4-(2-methoxyethylamino)phenyl]-2,3,5,6-tetramethylphenyl]aniline |
|---|---|
| PubChem CID | 142154386 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N-(2-methoxyethyl)-4-[4-[4-(2-methoxyethylamino)phenyl]-2,3,5,6-tetramethylphenyl]aniline |
| SMILES | COCCNc1ccc(-c2c(C)c(C)c(-c3ccc(NCCOC)cc3)c(C)c2C)cc1 |
| InChI | InChI=1S/C28H36N2O2/c1-19-20(2)28(24-9-13-26(14-10-24)30-16-18-32-6)22(4)21(3)27(19)23-7-11-25(12-8-23)29-15-17-31-5/h7-14,29-30H,15-18H2,1-6H3 |
| InChIKey | NRYIBMQHTWVRKI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|