C10H16N2O — CID 62911609
1-N-(2-methoxyethyl)-4-methylbenzene-1,3-diamine (PubChem CID 62911609) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-N-(2-methoxyethyl)-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-(2-methoxyethyl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 62911609 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-N-(2-methoxyethyl)-4-methylbenzene-1,3-diamine |
| SMILES | COCCNc1ccc(C)c(N)c1 |
| InChI | InChI=1S/C10H16N2O/c1-8-3-4-9(7-10(8)11)12-5-6-13-2/h3-4,7,12H,5-6,11H2,1-2H3 |
| InChIKey | BFKGIKOQWHKIPF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|