C8H12N2O3S — CID 21056335
4-methyl-1-N-(trioxidanylsulfanylmethyl)benzene-1,3-diamine (PubChem CID 21056335) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 4-methyl-1-N-(trioxidanylsulfanylmethyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-(trioxidanylsulfanylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 21056335 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 4-methyl-1-N-(trioxidanylsulfanylmethyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(NCSOOO)cc1N |
| InChI | InChI=1S/C8H12N2O3S/c1-6-2-3-7(4-8(6)9)10-5-14-13-12-11/h2-4,10-11H,5,9H2,1H3 |
| InChIKey | UIBXAUDDKNEMPK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|