C12H18N2O — CID 63295237
2-(3-amino-4-methylanilino)-1-cyclopropylethanol (PubChem CID 63295237) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(3-amino-4-methylanilino)-1-cyclopropylethanol.
| Compound Name | 2-(3-amino-4-methylanilino)-1-cyclopropylethanol |
|---|---|
| PubChem CID | 63295237 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(3-amino-4-methylanilino)-1-cyclopropylethanol |
| SMILES | Cc1ccc(NCC(O)C2CC2)cc1N |
| InChI | InChI=1S/C12H18N2O/c1-8-2-5-10(6-11(8)13)14-7-12(15)9-3-4-9/h2,5-6,9,12,14-15H,3-4,7,13H2,1H3 |
| InChIKey | AOOFORFBMWFAEG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|