C14H20N2O — CID 165483721
1-cyclopropyl-2-[(1-methyl-2,3-dihydroindol-5-yl)amino]ethanol (PubChem CID 165483721) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(1-methyl-2,3-dihydroindol-5-yl)amino]ethanol.
| Compound Name | 1-cyclopropyl-2-[(1-methyl-2,3-dihydroindol-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 165483721 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-cyclopropyl-2-[(1-methyl-2,3-dihydroindol-5-yl)amino]ethanol |
| SMILES | CN1CCc2cc(NCC(O)C3CC3)ccc21 |
| InChI | InChI=1S/C14H20N2O/c1-16-7-6-11-8-12(4-5-13(11)16)15-9-14(17)10-2-3-10/h4-5,8,10,14-15,17H,2-3,6-7,9H2,1H3 |
| InChIKey | MMWIDVCGFFACHB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|