C12H18N2S — CID 106425994
4-methyl-1-N-(2-prop-2-enylsulfanylethyl)benzene-1,3-diamine (PubChem CID 106425994) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 4-methyl-1-N-(2-prop-2-enylsulfanylethyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-(2-prop-2-enylsulfanylethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 106425994 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-methyl-1-N-(2-prop-2-enylsulfanylethyl)benzene-1,3-diamine |
| SMILES | C=CCSCCNc1ccc(C)c(N)c1 |
| InChI | InChI=1S/C12H18N2S/c1-3-7-15-8-6-14-11-5-4-10(2)12(13)9-11/h3-5,9,14H,1,6-8,13H2,2H3 |
| InChIKey | PFVGDBXIEGOBPS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|