C13H17N3S2 — CID 106425908
2-methyl-5-N-(2-prop-2-enylsulfanylethyl)-1,3-benzothiazole-5,6-diamine (PubChem CID 106425908) has the molecular formula C13H17N3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-methyl-5-N-(2-prop-2-enylsulfanylethyl)-1,3-benzothiazole-5,6-diamine.
| Compound Name | 2-methyl-5-N-(2-prop-2-enylsulfanylethyl)-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 106425908 |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-methyl-5-N-(2-prop-2-enylsulfanylethyl)-1,3-benzothiazole-5,6-diamine |
| SMILES | C=CCSCCNc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C13H17N3S2/c1-3-5-17-6-4-15-11-8-12-13(7-10(11)14)18-9(2)16-12/h3,7-8,15H,1,4-6,14H2,2H3 |
| InChIKey | BVLDCUYHEXCWFF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|