C11H12F3N3S — CID 63226065
2-methyl-5-N-(3,3,3-trifluoropropyl)-1,3-benzothiazole-5,6-diamine (PubChem CID 63226065) has the molecular formula C11H12F3N3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-methyl-5-N-(3,3,3-trifluoropropyl)-1,3-benzothiazole-5,6-diamine.
| Compound Name | 2-methyl-5-N-(3,3,3-trifluoropropyl)-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 63226065 |
| Molecular Formula | C11H12F3N3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-methyl-5-N-(3,3,3-trifluoropropyl)-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(NCCC(F)(F)F)c(N)cc2s1 |
| InChI | InChI=1S/C11H12F3N3S/c1-6-17-9-5-8(7(15)4-10(9)18-6)16-3-2-11(12,13)14/h4-5,16H,2-3,15H2,1H3 |
| InChIKey | HGWKYGIBRYDQTG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|