C14H20N4OS — CID 115355967
2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-tert-butylacetamide (PubChem CID 115355967) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-tert-butylacetamide.
| Compound Name | 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 115355967 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-tert-butylacetamide |
| SMILES | Cc1nc2cc(NCC(=O)NC(C)(C)C)c(N)cc2s1 |
| InChI | InChI=1S/C14H20N4OS/c1-8-17-11-6-10(9(15)5-12(11)20-8)16-7-13(19)18-14(2,3)4/h5-6,16H,7,15H2,1-4H3,(H,18,19) |
| InChIKey | GNTJHWSBDKMMCE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|