C15H21N3S — CID 107411223
2-methyl-5-N-[(3-methylcyclopentyl)methyl]-1,3-benzothiazole-5,6-diamine (PubChem CID 107411223) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-methyl-5-N-[(3-methylcyclopentyl)methyl]-1,3-benzothiazole-5,6-diamine.
| Compound Name | 2-methyl-5-N-[(3-methylcyclopentyl)methyl]-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 107411223 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-methyl-5-N-[(3-methylcyclopentyl)methyl]-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(NCC3CCC(C)C3)c(N)cc2s1 |
| InChI | InChI=1S/C15H21N3S/c1-9-3-4-11(5-9)8-17-13-7-14-15(6-12(13)16)19-10(2)18-14/h6-7,9,11,17H,3-5,8,16H2,1-2H3 |
| InChIKey | CRIAWUCZLJMONY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|