C11H16N4O2S2 — CID 106333917
2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-methylethanesulfonamide (PubChem CID 106333917) has the molecular formula C11H16N4O2S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106333917 |
| Molecular Formula | C11H16N4O2S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C11H16N4O2S2/c1-7-15-10-6-9(8(12)5-11(10)18-7)14-3-4-19(16,17)13-2/h5-6,13-14H,3-4,12H2,1-2H3 |
| InChIKey | PXIGIUWBNCPYQM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|