C13H16N6S — CID 63332779
2-methyl-5-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzothiazole-5,6-diamine (PubChem CID 63332779) has the molecular formula C13H16N6S and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-methyl-5-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzothiazole-5,6-diamine.
| Compound Name | 2-methyl-5-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 63332779 |
| Molecular Formula | C13H16N6S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-methyl-5-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(NCCc3nncn3C)c(N)cc2s1 |
| InChI | InChI=1S/C13H16N6S/c1-8-17-11-6-10(9(14)5-12(11)20-8)15-4-3-13-18-16-7-19(13)2/h5-7,15H,3-4,14H2,1-2H3 |
| InChIKey | XOBWVFJNBUVCGI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|