C13H18FN5O — CID 63592710
4-ethoxy-5-fluoro-2-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diamine (PubChem CID 63592710) has the molecular formula C13H18FN5O and a molecular weight of 279.32 g/mol. Its IUPAC name is 4-ethoxy-5-fluoro-2-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-ethoxy-5-fluoro-2-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 63592710 |
| Molecular Formula | C13H18FN5O |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-ethoxy-5-fluoro-2-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diamine |
| SMILES | CCOc1cc(NCCc2nncn2C)c(N)cc1F |
| InChI | InChI=1S/C13H18FN5O/c1-3-20-12-7-11(10(15)6-9(12)14)16-5-4-13-18-17-8-19(13)2/h6-8,16H,3-5,15H2,1-2H3 |
| InChIKey | HUTWOGVTCFLABE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|