C12H16N6O — CID 63356921
4-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide (PubChem CID 63356921) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide.
| Compound Name | 4-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 63356921 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide |
| SMILES | Cn1cnnc1CCNc1cc(C(N)=O)ccc1N |
| InChI | InChI=1S/C12H16N6O/c1-18-7-16-17-11(18)4-5-15-10-6-8(12(14)19)2-3-9(10)13/h2-3,6-7,15H,4-5,13H2,1H3,(H2,14,19) |
| InChIKey | GOYOTPXWGRFEJB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|