C14H24N2O4 — CID 150016700
2-[2-[2-[2-(4-aminoanilino)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 150016700) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-aminoanilino)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-(4-aminoanilino)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 150016700 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[2-[2-[2-(4-aminoanilino)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | Nc1ccc(NCCOCCOCCOCCO)cc1 |
| InChI | InChI=1S/C14H24N2O4/c15-13-1-3-14(4-2-13)16-5-7-18-9-11-20-12-10-19-8-6-17/h1-4,16-17H,5-12,15H2 |
| InChIKey | DEKLXWOQHIJELZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|