C12H17F2N3O — CID 113409518
3-(2-amino-3,5-difluoroanilino)-N-propan-2-ylpropanamide (PubChem CID 113409518) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 3-(2-amino-3,5-difluoroanilino)-N-propan-2-ylpropanamide.
| Compound Name | 3-(2-amino-3,5-difluoroanilino)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 113409518 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 3-(2-amino-3,5-difluoroanilino)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C12H17F2N3O/c1-7(2)17-11(18)3-4-16-10-6-8(13)5-9(14)12(10)15/h5-7,16H,3-4,15H2,1-2H3,(H,17,18) |
| InChIKey | GVHLLKDXKICZQV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|