C14H25N3O2 — CID 122557604
N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]piperidine-4-carboxamide (PubChem CID 122557604) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]piperidine-4-carboxamide.
| Compound Name | N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 122557604 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]piperidine-4-carboxamide |
| SMILES | O=C(N[C@H]1COC[C@@H]1N1CCCC1)C1CCNCC1 |
| InChI | InChI=1S/C14H25N3O2/c18-14(11-3-5-15-6-4-11)16-12-9-19-10-13(12)17-7-1-2-8-17/h11-13,15H,1-10H2,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | GEEGSFLXRBQPNZ-STQMWFEESA-N |
| XLogP | -0.03 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |