C17H16ClN3O3S — CID 47054951
3-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide (PubChem CID 47054951) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 47054951 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)s1)Nc1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C17H16ClN3O3S/c18-14-6-4-13(25-14)5-7-15(22)20-12-3-1-2-11(8-12)10-21-16(23)9-19-17(21)24/h1-4,6,8H,5,7,9-10H2,(H,19,24)(H,20,22) |
| InChIKey | VGNVDHAHCCZXNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|