C18H13ClN4O3S2 — CID 60583658
2-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 60583658) has the molecular formula C18H13ClN4O3S2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 60583658 |
| Molecular Formula | C18H13ClN4O3S2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)c1csc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C18H13ClN4O3S2/c19-14-5-4-13(28-14)17-22-12(9-27-17)16(25)21-11-3-1-2-10(6-11)8-23-15(24)7-20-18(23)26/h1-6,9H,7-8H2,(H,20,26)(H,21,25) |
| InChIKey | OODXRABUYZXSTR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|