C13H16N4O3 — CID 119288680
2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide (PubChem CID 119288680) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide.
| Compound Name | 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 119288680 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]propanamide |
| SMILES | CC(N)C(=O)Nc1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C13H16N4O3/c1-8(14)12(19)16-10-4-2-3-9(5-10)7-17-11(18)6-15-13(17)20/h2-5,8H,6-7,14H2,1H3,(H,15,20)(H,16,19) |
| InChIKey | ZCNAYVGEWJDJJV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|