C20H21N3O4 — CID 55617362
N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(2-ethylphenoxy)acetamide (PubChem CID 55617362) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(2-ethylphenoxy)acetamide.
| Compound Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(2-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 55617362 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(2-ethylphenoxy)acetamide |
| SMILES | CCc1ccccc1OCC(=O)Nc1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-2-15-7-3-4-9-17(15)27-13-18(24)22-16-8-5-6-14(10-16)12-23-19(25)11-21-20(23)26/h3-10H,2,11-13H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | MAHUBUFMPZGVPC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|