C21H19BrN4O3 — CID 52661750
2-(3-bromo-2-methylindol-1-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide (PubChem CID 52661750) has the molecular formula C21H19BrN4O3 and a molecular weight of 455.31 g/mol. Its IUPAC name is 2-(3-bromo-2-methylindol-1-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide.
| Compound Name | 2-(3-bromo-2-methylindol-1-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 52661750 |
| Molecular Formula | C21H19BrN4O3 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-(3-bromo-2-methylindol-1-yl)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)Nc1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C21H19BrN4O3/c1-13-20(22)16-7-2-3-8-17(16)25(13)12-18(27)24-15-6-4-5-14(9-15)11-26-19(28)10-23-21(26)29/h2-9H,10-12H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | PORULZVVIXMNHW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|