C15H18N4O3 — CID 119288678
N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 119288678) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119288678 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)C1CCCN1 |
| InChI | InChI=1S/C15H18N4O3/c20-13-8-17-15(22)19(13)9-10-3-1-4-11(7-10)18-14(21)12-5-2-6-16-12/h1,3-4,7,12,16H,2,5-6,8-9H2,(H,17,22)(H,18,21) |
| InChIKey | MCBXIFHSJBMKGF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|