C20H20N4O4S — CID 55939052
(2S)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 55939052) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is (2S)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55939052 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (2S)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)[C@@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H20N4O4S/c25-17-11-21-20(28)24(17)12-13-4-1-5-14(10-13)22-18(26)15-6-2-8-23(15)19(27)16-7-3-9-29-16/h1,3-5,7,9-10,15H,2,6,8,11-12H2,(H,21,28)(H,22,26)/t15-/m0/s1 |
| InChIKey | OEAQEMSJWSKFQL-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|