C22H27N3O4S2 — CID 55943962
(2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 55943962) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is (2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55943962 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCCC2)c1)[C@@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C22H27N3O4S2/c26-21(19-10-6-14-25(19)22(27)20-11-7-15-30-20)23-17-8-5-9-18(16-17)31(28,29)24-12-3-1-2-4-13-24/h5,7-9,11,15-16,19H,1-4,6,10,12-14H2,(H,23,26)/t19-/m0/s1 |
| InChIKey | PXOIPOVTHHQBKH-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |