C24H24N4O3S — CID 32953422
(2R)-N-[4-(phenylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 32953422) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is (2R)-N-[4-(phenylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-[4-(phenylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 32953422 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (2R)-N-[4-(phenylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NC(=O)[C@H]2CCCCN2C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H24N4O3S/c29-22(20-9-4-5-15-28(20)23(30)21-10-6-16-32-21)25-18-11-13-19(14-12-18)27-24(31)26-17-7-2-1-3-8-17/h1-3,6-8,10-14,16,20H,4-5,9,15H2,(H,25,29)(H2,26,27,31)/t20-/m1/s1 |
| InChIKey | WGUZYNJIEXVNSX-HXUWFJFHSA-N |
| XLogP | 5.03 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |